Clavicipitic acid

Oeryc:


{{Chembox
| ImageFile = Clavicipitic acid.svg
| Section1 = {{Chembox Identifiers
| CASNo =
| CASNo_Ref
| UNII
| UNII =
| PubChem = 10265155
| ChemSpiderID =
| SMILES = CC(=CC1C2=C3C(=CNC3=CC=C2)CC(N1)C(=O)O)C
| InChI = 1S/C16H18N2O2/c1-9(2)6-13-11-4-3-5-12-15(11)10(8-17-12)7-14(18-13)16(19)20/h3-6,8,13-14,17-18H,7H2,1-2H3,(H,19,20)
| InChIKey = VZMAHZAQMKNJIG-UHFFFAOYSA-N
}}
| Section2 = {{Chembox Properties
| Formula = C16H18N2O2
| MolarMass = 270.33 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
| Solubility =
}}
}}

”’Clavicipitic acid”’ is an [[Ergoline|ergoline-related]] [[Ergoline|compound]] found in [[ergot]]; it is a [[tricyclic]] [[indole alkaloid]], but is in fact an [[amino acid]] that can be described as a specific [[Structural analog|structural analogue]] of [[Ergine|lysergamide]] (ergine).<ref>{{Cite journal |last=Robbers |first=J. E. |last2=Floss |first2=H. G. |date= |title=Clavicipitic acid, a new 4-substituted indolic amino acid obtained from submerged cultures of the ergot fungus |url=https://pubmed.ncbi.nlm.nih.gov/5794444 |journal=Tetrahedron Letters |issue=23 |pages=1857–1858 |doi=10.1016/s0040-4039(01)88031-x |issn=0040-4039 |pmid=5794444}}</ref><ref name=”:1″>{{Cite journal |last=Robbers |first=James E. |last2=Otsuka |first2=Hideaki |last3=Floss |first3=Heinz G. |last4=Arnold |first4=Edward V. |last5=Clardy |first5=Jon |date=1980-03-01 |title=Clavicipitic acid: its structure, biosynthesis, and role in ergot alkaloid formation |url=https://doi.org/10.1021/jo01294a039 |journal=The Journal of Organic Chemistry |volume=45 |issue=6 |pages=1117–1121 |doi=10.1021/jo01294a039 |issn=0022-3263}}</ref>

Clavicipitic acid, a metabolite of ”Claviceps”, is a mixture of isomers formed from [[tryptophan]] and [[mevalonic acid]], but does not subsequently convert into the tetracyclic [[elymoclavine]]. Its formation represents a deviation in the [[biosynthesis]] of ergoline-based compounds following the first stage specific to this pathway, namely the [[Prenylation|isoprenylation]] of tryptophan.<ref name=”:1″ />

Loading


Leave a comment

لن يتم نشر عنوان بريدك الإلكتروني. الحقول الإلزامية مشار إليها بـ *