Eyad0308: ←Created page with ‘{{Short description|none}} {{Use British English|date=September 2026}} {{Use dmy dates|date=September 2026}} {{Infobox election | election_name = | country = Syria | flag_year = 1932 | type = parliamentary | ongoing = no | previous_election = 1936 Syrian
Riceboxpoulet: /* Tennis Career */ {{short description|Italian tennis player (born 2004)}} {{Use dmy dates|date=September 2026}} {{Infobox tennis biography | name = Samira De Stefano | country = {{ITA}} | birth_date = {{Birth date and age|2004|5|6|df=y}} | plays = Left-handed |
Praseodymium-141: rmv cat {{Chembox | Name = Oxovanadium(IV) perchlorate | OtherNames = {{ubl|Vanadyl diperchlorate|Vanadium(IV) oxo perchlorate}} |Section1={{Chembox Identifiers | CASNo = 15305-73-4 | CASNo_Ref = {{cascite|correct|CAS}} | CASNo2 = 15333-33-2 | CASNo2_Comment = pentahydrate | SMILES = O=[V+2].[O-]Cl(=O)(=O)=O.[O-]Cl(=O)(=O)=O }} |Section2={{Chembox
B33tleMania12: ←Created page with ‘{{Short description|Species of beetle}} {{Speciesbox | image = Canthidium_viridiobscurum.jpg | image_caption = | image2 = | image2_caption = | genus= Canthidium | species = viridiobscurum | authority = Boucomont, 1928 | synonyms = }} ””’Canthidium viridiobscurum””’
B33tleMania12: ←Created page with ‘{{Short description|Species of beetle}} {{Speciesbox | image = Canthidium_multipunctatum.jpg | image_caption = | image2 = | image2_caption = | genus= Canthidium | species = multipunctatum | authority = Balthasar, 1939 | synonyms = }} ””’Canthidium multipunctatum””’
Eyad0308: ←Created page with ‘{{Short description|none}} {{Use British English|date=September 2026}} {{Use dmy dates|date=September 2026}} {{Infobox election | election_name = | country = Syria | flag_year = 1932 | type = parliamentary | previous_election = 1931–1932 Syrian parliamentary election | previous_year
Caltine: {{Short description|none}} {{Use British English|date=September 2026}} {{Use dmy dates|date=September 2026}} {{Infobox election | election_name = 1931–1932 Syrian parliamentary election | country = Syria | flag_year = 1932 | type = parliamentary | previous_election = 1928 Syrian Constituent Assembly election
Arjayay: Duplicate word removed {{Short description|none}} {{Use British English|date=September 2026}} {{Use dmy dates|date=September 2026}} {{Infobox election | election_name = | country = State of Syria | type = parliamentary | previous_election = | next_election = 1931–1932 Syrian parliamentary election |
Eyad0308: ←Created page with ‘{{Short description|none}} {{Use British English|date=September 2026}} {{Use dmy dates|date=September 2026}} The ”’1919 Syrian National Congress election”’ was an electoral process held in May–June 1919 to choose representatives to the Syrian National Congress, a constituent assembly convened
Praseodymium-141: + {{Chembox | Name = Holmium perchlorate | OtherNames = Holmium(III) perchlorate |Section1={{Chembox Identifiers | CASNo = 14017-54-0 | CASNo_Ref = {{cascite|correct|CAS}} | CASNo2 = 14692-19-4 | CASNo2_Comment = octahydrate | CASNo3 = 14692-16-1 | CASNo3_Comment = nonahydrate }}
