Category: Posts

LivingLife1976: Creating film stub {{Use dmy dates|date=September 2026}} {{Use Indian English|date=September 2026}} {{Infobox film | name = Radhika | image = | caption = | director = [[Virendra Desai]] | producer = | writer = | narrator = | starring

System tinker 90: Create article on Check24, covering its history and services {{Short description|German price comparison company}} {{Use dmy dates|date=September 2026}} {{Infobox company | name = Check24 | industry = Price comparison | founded = {{Start date and age|1999}} |

Oeryc: {{Chembox | ImageFile = Clavicipitic acid.svg | Section1 = {{Chembox Identifiers | CASNo = | CASNo_Ref | UNII | UNII = | PubChem = 10265155 | ChemSpiderID = | SMILES = CC(=CC1C2=C3C(=CNC3=CC=C2)CC(N1)C(=O)O)C | InChI = 1S/C16H18N2O2/c1-9(2)6-13-11-4-3-5-12-15(11)10(8-17-12)7-14(18-13)16(19)20/h3-6,8,13-14,17-18H,7H2,1-2H3,(H,19,20) | InChIKey =

Mr.Ibrahembot: بوت:إزالة قالب:وصلة إنترويكي من وصلة زرقاء {{صندوق معلومات موسم مسلسل تلفزيوني | اسم الموسم = [[ديكستر (مسلسل)|ديكستر]]<br> <small>الموسم الرابع</small> | الخلفية = #00607B | صورة = Dexter season 4 DVD.jpg | عنوان الصورة = غلاف إصدار الدي ڤي دي

B33tleMania12: ←Created page with ‘{{Short description|Species of beetle}} {{Speciesbox | image = Trichillidium_quadridens.jpg | image_caption = | image2 = | image2_caption = | genus= Trichillidium | species = quadridens | authority = (Arrow, 1932) | synonyms = *”Pedaridium quadridens” <small>Arrow,

B33tleMania12: ←Created page with ‘{{Short description|Genus of beetles}} {{Automatic taxobox | image = Trichillidium_quadridens.jpg | image_caption = ”Trichillidium quadridens” | display_parents = 2 | taxon = Trichillidium | authority = Vaz-de-Mello, 2008 | type_species = | type_species_authority = | synonyms

Davidindia: added Category:Sportswomen from Tamil Nadu using HotCat {{Short description|Indian athlete}} {{Use dmy dates|date=September 2026}} {{Use Indian English|date=September 2026}} ”’Gowthami Jayaraman”’ (born 1999) is an Indian [[Discus throw|discus thrower]]. She qualified to represent India in women’s 800 metre event, along

ᱤᱧ ᱢᱟᱛᱟᱞ: added Category:20th-century Bangladeshi male actors using HotCat {{Short description|Bangladeshi television actor (born 1974)}} {{Use dmy dates|date=September 2026}} {{Infobox person | name = A K M Hasan | image = Abu Kha M Hasan in Dhaka, 2019 002.jpg |

Bucketneer: Added references list and cover art. {{Use mdy dates|date=September 2026}} {{Infobox song | name = Loser/Number Nine | cover = Kenshi Yonezu – Loser-Number Nine.jpg | type = single | artist = [[Kenshi Yonezu]] | album = [[Bootleg (Kenshi

Aziza Umarova: /* */ {{Short description|2026 Uzbek TV drama}} {{Use dmy dates|date=September 2026}} {{Infobox television | image = | alt = | alt_name = | genre = | based_on = | writer = {{Plainlist| * Azim Yuldashev * Elshan Namazly